C16H24Cl2N2O — CID 46245260
2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 46245260) has the molecular formula C16H24Cl2N2O and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 46245260 |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNCC[C@]1(c2ccc(Cl)c(Cl)c2)CCCNC1 |
| InChI | InChI=1S/C16H24Cl2N2O/c1-21-10-9-19-8-6-16(5-2-7-20-12-16)13-3-4-14(17)15(18)11-13/h3-4,11,19-20H,2,5-10,12H2,1H3/t16-/m1/s1 |
| InChIKey | UQMKYAHKJZUILU-MRXNPFEDSA-N |
| XLogP | 3.24 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|