C20H13BrN4O5 — CID 46245842
6-(5-bromo-2-methoxyphenyl)-3-(3-nitrophenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid (PubChem CID 46245842) has the molecular formula C20H13BrN4O5 and a molecular weight of 469.25 g/mol. Its IUPAC name is 6-(5-bromo-2-methoxyphenyl)-3-(3-nitrophenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid.
| Compound Name | 6-(5-bromo-2-methoxyphenyl)-3-(3-nitrophenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 46245842 |
| Molecular Formula | C20H13BrN4O5 |
| Molecular Weight | 469.25 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 6-(5-bromo-2-methoxyphenyl)-3-(3-nitrophenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid |
| SMILES | COc1ccc(Br)cc1-c1cc(C(=O)O)c2c(-c3cccc([N+](=O)[O-])c3)[nH]nc2n1 |
| InChI | InChI=1S/C20H13BrN4O5/c1-30-16-6-5-11(21)8-13(16)15-9-14(20(26)27)17-18(23-24-19(17)22-15)10-3-2-4-12(7-10)25(28)29/h2-9H,1H3,(H,26,27)(H,22,23,24) |
| InChIKey | DESUIMWTFFBXOU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|