C26H23ClN4O5 — CID 46247371
N-[2-(4-chlorophenyl)ethyl]-3-[1-[(4-nitrophenyl)methyl]-2,4-dioxoquinazolin-3-yl]propanamide (PubChem CID 46247371) has the molecular formula C26H23ClN4O5 and a molecular weight of 506.95 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-3-[1-[(4-nitrophenyl)methyl]-2,4-dioxoquinazolin-3-yl]propanamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-3-[1-[(4-nitrophenyl)methyl]-2,4-dioxoquinazolin-3-yl]propanamide |
|---|---|
| PubChem CID | 46247371 |
| Molecular Formula | C26H23ClN4O5 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-3-[1-[(4-nitrophenyl)methyl]-2,4-dioxoquinazolin-3-yl]propanamide |
| SMILES | O=C(CCn1c(=O)c2ccccc2n(Cc2ccc([N+](=O)[O-])cc2)c1=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H23ClN4O5/c27-20-9-5-18(6-10-20)13-15-28-24(32)14-16-29-25(33)22-3-1-2-4-23(22)30(26(29)34)17-19-7-11-21(12-8-19)31(35)36/h1-12H,13-17H2,(H,28,32) |
| InChIKey | GBHBFVVINMVEQV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|