C25H26N6O — CID 46248995
N-cyclopentyl-4-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]benzamide (PubChem CID 46248995) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is N-cyclopentyl-4-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]benzamide.
| Compound Name | N-cyclopentyl-4-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 46248995 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-cyclopentyl-4-[[3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]amino]benzamide |
| SMILES | Cc1cc(C)n(-c2nc3ccccc3nc2Nc2ccc(C(=O)NC3CCCC3)cc2)n1 |
| InChI | InChI=1S/C25H26N6O/c1-16-15-17(2)31(30-16)24-23(28-21-9-5-6-10-22(21)29-24)26-20-13-11-18(12-14-20)25(32)27-19-7-3-4-8-19/h5-6,9-15,19H,3-4,7-8H2,1-2H3,(H,26,28)(H,27,32) |
| InChIKey | CVTZSQMZYVQUJT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |