C20H17Cl2N5OS — CID 46253029
(6E)-2-butyl-6-[[1-(2,3-dichlorophenyl)pyrrol-2-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46253029) has the molecular formula C20H17Cl2N5OS and a molecular weight of 446.36 g/mol. Its IUPAC name is (6E)-2-butyl-6-[[1-(2,3-dichlorophenyl)pyrrol-2-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-2-butyl-6-[[1-(2,3-dichlorophenyl)pyrrol-2-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46253029 |
| Molecular Formula | C20H17Cl2N5OS |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | (6E)-2-butyl-6-[[1-(2,3-dichlorophenyl)pyrrol-2-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cccn2-c2cccc(Cl)c2Cl)/C(=O)N=C2SC(CCCC)=NN2/1 |
| InChI | InChI=1S/C20H17Cl2N5OS/c1-2-3-9-16-25-27-18(23)13(19(28)24-20(27)29-16)11-12-6-5-10-26(12)15-8-4-7-14(21)17(15)22/h4-8,10-11,23H,2-3,9H2,1H3/b13-11+,23-18- |
| InChIKey | MPZXQXSFRBWTFJ-GLZSIORYSA-N |
| XLogP | 5.59 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|