C33H32N2O6S — CID 46255486
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(2,5-dimethylphenyl)methyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 46255486) has the molecular formula C33H32N2O6S and a molecular weight of 584.69 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(2,5-dimethylphenyl)methyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(2,5-dimethylphenyl)methyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 46255486 |
| Molecular Formula | C33H32N2O6S |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(2,5-dimethylphenyl)methyl]-6,11,11-trioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc3c(c2)N(Cc2cc(C)ccc2C)C(=O)c2ccccc2S3(=O)=O)cc1OC |
| InChI | InChI=1S/C33H32N2O6S/c1-21-9-10-22(2)25(17-21)20-35-27-19-24(32(36)34-16-15-23-11-13-28(40-3)29(18-23)41-4)12-14-31(27)42(38,39)30-8-6-5-7-26(30)33(35)37/h5-14,17-19H,15-16,20H2,1-4H3,(H,34,36) |
| InChIKey | DCZKNNPOBREISY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |