C31H26N4O6S — CID 46255498
5-benzyl-3-[4-(4-nitrophenyl)piperazine-1-carbonyl]-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one (PubChem CID 46255498) has the molecular formula C31H26N4O6S and a molecular weight of 582.64 g/mol. Its IUPAC name is 5-benzyl-3-[4-(4-nitrophenyl)piperazine-1-carbonyl]-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 5-benzyl-3-[4-(4-nitrophenyl)piperazine-1-carbonyl]-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 46255498 |
| Molecular Formula | C31H26N4O6S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 5-benzyl-3-[4-(4-nitrophenyl)piperazine-1-carbonyl]-11,11-dioxobenzo[b][1,4]benzothiazepin-6-one |
| SMILES | O=C(c1ccc2c(c1)N(Cc1ccccc1)C(=O)c1ccccc1S2(=O)=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C31H26N4O6S/c36-30(33-18-16-32(17-19-33)24-11-13-25(14-12-24)35(38)39)23-10-15-29-27(20-23)34(21-22-6-2-1-3-7-22)31(37)26-8-4-5-9-28(26)42(29,40)41/h1-15,20H,16-19,21H2 |
| InChIKey | XHGQFKKTDUKGDC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|