C23H19N3O5S — CID 46256198
8-methyl-2-[4-(4-nitrophenyl)piperazine-1-carbonyl]thieno[3,2-c]chromen-4-one (PubChem CID 46256198) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is 8-methyl-2-[4-(4-nitrophenyl)piperazine-1-carbonyl]thieno[3,2-c]chromen-4-one.
| Compound Name | 8-methyl-2-[4-(4-nitrophenyl)piperazine-1-carbonyl]thieno[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 46256198 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 8-methyl-2-[4-(4-nitrophenyl)piperazine-1-carbonyl]thieno[3,2-c]chromen-4-one |
| SMILES | Cc1ccc2oc(=O)c3cc(C(=O)N4CCN(c5ccc([N+](=O)[O-])cc5)CC4)sc3c2c1 |
| InChI | InChI=1S/C23H19N3O5S/c1-14-2-7-19-17(12-14)21-18(23(28)31-19)13-20(32-21)22(27)25-10-8-24(9-11-25)15-3-5-16(6-4-15)26(29)30/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | IHMOQQFAXWGCDL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|