C20H16Cl2N2O — CID 46256308
9-chloro-N-(2-chlorophenyl)-5,6,7,8-tetrahydroacridine-3-carboxamide (PubChem CID 46256308) has the molecular formula C20H16Cl2N2O and a molecular weight of 371.27 g/mol. Its IUPAC name is 9-chloro-N-(2-chlorophenyl)-5,6,7,8-tetrahydroacridine-3-carboxamide.
| Compound Name | 9-chloro-N-(2-chlorophenyl)-5,6,7,8-tetrahydroacridine-3-carboxamide |
|---|---|
| PubChem CID | 46256308 |
| Molecular Formula | C20H16Cl2N2O |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 9-chloro-N-(2-chlorophenyl)-5,6,7,8-tetrahydroacridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1ccc2c(Cl)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C20H16Cl2N2O/c21-15-6-2-4-8-17(15)24-20(25)12-9-10-14-18(11-12)23-16-7-3-1-5-13(16)19(14)22/h2,4,6,8-11H,1,3,5,7H2,(H,24,25) |
| InChIKey | IDMUUDSGHMCBHB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |