C24H21FN2O2S2 — CID 46257450
(E)-2-(benzenesulfonyl)-3-(2-ethylanilino)-3-[(4-fluorophenyl)methylsulfanyl]prop-2-enenitrile (PubChem CID 46257450) has the molecular formula C24H21FN2O2S2 and a molecular weight of 452.58 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-(2-ethylanilino)-3-[(4-fluorophenyl)methylsulfanyl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-(2-ethylanilino)-3-[(4-fluorophenyl)methylsulfanyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 46257450 |
| Molecular Formula | C24H21FN2O2S2 |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-(2-ethylanilino)-3-[(4-fluorophenyl)methylsulfanyl]prop-2-enenitrile |
| SMILES | CCc1ccccc1N/C(SCc1ccc(F)cc1)=C(/C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21FN2O2S2/c1-2-19-8-6-7-11-22(19)27-24(30-17-18-12-14-20(25)15-13-18)23(16-26)31(28,29)21-9-4-3-5-10-21/h3-15,27H,2,17H2,1H3/b24-23+ |
| InChIKey | JPMQYBBSUAAOPQ-WCWDXBQESA-N |
| XLogP | 5.90 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|