C26H25FN2O2S2 — CID 46257461
(E)-2-(benzenesulfonyl)-3-(2,6-diethylanilino)-3-[(3-fluorophenyl)methylsulfanyl]prop-2-enenitrile (PubChem CID 46257461) has the molecular formula C26H25FN2O2S2 and a molecular weight of 480.63 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-(2,6-diethylanilino)-3-[(3-fluorophenyl)methylsulfanyl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-(2,6-diethylanilino)-3-[(3-fluorophenyl)methylsulfanyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 46257461 |
| Molecular Formula | C26H25FN2O2S2 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-(2,6-diethylanilino)-3-[(3-fluorophenyl)methylsulfanyl]prop-2-enenitrile |
| SMILES | CCc1cccc(CC)c1N/C(SCc1cccc(F)c1)=C(/C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25FN2O2S2/c1-3-20-11-9-12-21(4-2)25(20)29-26(32-18-19-10-8-13-22(27)16-19)24(17-28)33(30,31)23-14-6-5-7-15-23/h5-16,29H,3-4,18H2,1-2H3/b26-24+ |
| InChIKey | LNJDPNUEXAAGFA-SHHOIMCASA-N |
| XLogP | 6.46 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|