C25H23ClN2O2S2 — CID 46257518
(E)-2-(benzenesulfonyl)-3-[(3-chlorophenyl)methylsulfanyl]-3-(2,4,6-trimethylanilino)prop-2-enenitrile (PubChem CID 46257518) has the molecular formula C25H23ClN2O2S2 and a molecular weight of 483.06 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-[(3-chlorophenyl)methylsulfanyl]-3-(2,4,6-trimethylanilino)prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-[(3-chlorophenyl)methylsulfanyl]-3-(2,4,6-trimethylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 46257518 |
| Molecular Formula | C25H23ClN2O2S2 |
| Molecular Weight | 483.06 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-[(3-chlorophenyl)methylsulfanyl]-3-(2,4,6-trimethylanilino)prop-2-enenitrile |
| SMILES | Cc1cc(C)c(N/C(SCc2cccc(Cl)c2)=C(/C#N)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H23ClN2O2S2/c1-17-12-18(2)24(19(3)13-17)28-25(31-16-20-8-7-9-21(26)14-20)23(15-27)32(29,30)22-10-5-4-6-11-22/h4-14,28H,16H2,1-3H3/b25-23+ |
| InChIKey | SVNSCTRYBKTONT-WJTDDFOZSA-N |
| XLogP | 6.78 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.06 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|