C13H18N4O5 — CID 46257753
ethyl 4-[2,2-dimethoxyethyl(methyl)amino]-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylate (PubChem CID 46257753) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is ethyl 4-[2,2-dimethoxyethyl(methyl)amino]-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylate.
| Compound Name | ethyl 4-[2,2-dimethoxyethyl(methyl)amino]-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 46257753 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethyl 4-[2,2-dimethoxyethyl(methyl)amino]-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1noc2ncnc(N(C)CC(OC)OC)c12 |
| InChI | InChI=1S/C13H18N4O5/c1-5-21-13(18)10-9-11(14-7-15-12(9)22-16-10)17(2)6-8(19-3)20-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | RQPXGEWQPMQRJK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 99.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|