C20H24N4O5S — CID 46258122
ethyl 4-[4-[benzenesulfonyl(methyl)amino]pyridine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 46258122) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is ethyl 4-[4-[benzenesulfonyl(methyl)amino]pyridine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[benzenesulfonyl(methyl)amino]pyridine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46258122 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | ethyl 4-[4-[benzenesulfonyl(methyl)amino]pyridine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(N(C)S(=O)(=O)c3ccccc3)ccn2)CC1 |
| InChI | InChI=1S/C20H24N4O5S/c1-3-29-20(26)24-13-11-23(12-14-24)19(25)18-15-16(9-10-21-18)22(2)30(27,28)17-7-5-4-6-8-17/h4-10,15H,3,11-14H2,1-2H3 |
| InChIKey | STWNMZYGCDRNFT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |