C21H21F3N4O2 — CID 46262542
1-[5-(4-tert-butylanilino)-2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]ethanone (PubChem CID 46262542) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is 1-[5-(4-tert-butylanilino)-2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]ethanone.
| Compound Name | 1-[5-(4-tert-butylanilino)-2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 46262542 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[5-(4-tert-butylanilino)-2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]ethanone |
| SMILES | CC(=O)c1nn(-c2ccc(OC(F)(F)F)cc2)nc1Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H21F3N4O2/c1-13(29)18-19(25-15-7-5-14(6-8-15)20(2,3)4)27-28(26-18)16-9-11-17(12-10-16)30-21(22,23)24/h5-12H,1-4H3,(H,25,27) |
| InChIKey | YRWCRMDEWWXQSZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |