C22H22F3N5O2 — CID 46262675
1-[5-(2-piperidin-1-ylanilino)-2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]ethanone (PubChem CID 46262675) has the molecular formula C22H22F3N5O2 and a molecular weight of 445.45 g/mol. Its IUPAC name is 1-[5-(2-piperidin-1-ylanilino)-2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]ethanone.
| Compound Name | 1-[5-(2-piperidin-1-ylanilino)-2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 46262675 |
| Molecular Formula | C22H22F3N5O2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[5-(2-piperidin-1-ylanilino)-2-[4-(trifluoromethoxy)phenyl]triazol-4-yl]ethanone |
| SMILES | CC(=O)c1nn(-c2ccc(OC(F)(F)F)cc2)nc1Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C22H22F3N5O2/c1-15(31)20-21(26-18-7-3-4-8-19(18)29-13-5-2-6-14-29)28-30(27-20)16-9-11-17(12-10-16)32-22(23,24)25/h3-4,7-12H,2,5-6,13-14H2,1H3,(H,26,28) |
| InChIKey | PJWRZPHUZFPVKK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |