C25H30N6O5 — CID 46263509
ethyl 4-[[5-[(3-nitrobenzoyl)amino]-1-propan-2-ylbenzimidazol-2-yl]methyl]piperazine-1-carboxylate (PubChem CID 46263509) has the molecular formula C25H30N6O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is ethyl 4-[[5-[(3-nitrobenzoyl)amino]-1-propan-2-ylbenzimidazol-2-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[5-[(3-nitrobenzoyl)amino]-1-propan-2-ylbenzimidazol-2-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46263509 |
| Molecular Formula | C25H30N6O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | ethyl 4-[[5-[(3-nitrobenzoyl)amino]-1-propan-2-ylbenzimidazol-2-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2nc3cc(NC(=O)c4cccc([N+](=O)[O-])c4)ccc3n2C(C)C)CC1 |
| InChI | InChI=1S/C25H30N6O5/c1-4-36-25(33)29-12-10-28(11-13-29)16-23-27-21-15-19(8-9-22(21)30(23)17(2)3)26-24(32)18-6-5-7-20(14-18)31(34)35/h5-9,14-15,17H,4,10-13,16H2,1-3H3,(H,26,32) |
| InChIKey | YFEMQHOHVANNDO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|