C18H19N5O7 — CID 4626402
2-(tert-butylamino)-N-(2-methyl-5-nitrophenyl)-3,5-dinitrobenzamide (PubChem CID 4626402) has the molecular formula C18H19N5O7 and a molecular weight of 417.38 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-(2-methyl-5-nitrophenyl)-3,5-dinitrobenzamide.
| Compound Name | 2-(tert-butylamino)-N-(2-methyl-5-nitrophenyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4626402 |
| Molecular Formula | C18H19N5O7 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-(tert-butylamino)-N-(2-methyl-5-nitrophenyl)-3,5-dinitrobenzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1NC(C)(C)C |
| InChI | InChI=1S/C18H19N5O7/c1-10-5-6-11(21(25)26)8-14(10)19-17(24)13-7-12(22(27)28)9-15(23(29)30)16(13)20-18(2,3)4/h5-9,20H,1-4H3,(H,19,24) |
| InChIKey | PEUILYIMOCVVDI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|