C22H29N5O2 — CID 46264397
5-(4-benzylpiperazine-1-carbonyl)-N-cyclohexyl-1H-imidazole-4-carboxamide (PubChem CID 46264397) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 5-(4-benzylpiperazine-1-carbonyl)-N-cyclohexyl-1H-imidazole-4-carboxamide.
| Compound Name | 5-(4-benzylpiperazine-1-carbonyl)-N-cyclohexyl-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46264397 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 5-(4-benzylpiperazine-1-carbonyl)-N-cyclohexyl-1H-imidazole-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1nc[nH]c1C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N5O2/c28-21(25-18-9-5-2-6-10-18)19-20(24-16-23-19)22(29)27-13-11-26(12-14-27)15-17-7-3-1-4-8-17/h1,3-4,7-8,16,18H,2,5-6,9-15H2,(H,23,24)(H,25,28) |
| InChIKey | GDIJQEQIKDXFQY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |