C22H19N3OS — CID 46265783
2-[(3-cyano-6-phenyl-2-pyridinyl)sulfanyl]-N-(1-phenylethyl)acetamide (PubChem CID 46265783) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-[(3-cyano-6-phenyl-2-pyridinyl)sulfanyl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[(3-cyano-6-phenyl-2-pyridinyl)sulfanyl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 46265783 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[(3-cyano-6-phenyl-2-pyridinyl)sulfanyl]-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CSc1nc(-c2ccccc2)ccc1C#N)c1ccccc1 |
| InChI | InChI=1S/C22H19N3OS/c1-16(17-8-4-2-5-9-17)24-21(26)15-27-22-19(14-23)12-13-20(25-22)18-10-6-3-7-11-18/h2-13,16H,15H2,1H3,(H,24,26) |
| InChIKey | KJNIDLOGZAUWIJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |