C25H24N4O — CID 46268807
N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)phenyl]-3-phenylpropanamide (PubChem CID 46268807) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)phenyl]-3-phenylpropanamide.
| Compound Name | N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 46268807 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(N2CCn3c(nc4ccccc43)C2)cc1 |
| InChI | InChI=1S/C25H24N4O/c30-25(15-10-19-6-2-1-3-7-19)26-20-11-13-21(14-12-20)28-16-17-29-23-9-5-4-8-22(23)27-24(29)18-28/h1-9,11-14H,10,15-18H2,(H,26,30) |
| InChIKey | IAVGQHIFDSGBNL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|