C21H24N4O — CID 46268849
N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)-2-methylphenyl]butanamide (PubChem CID 46268849) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)-2-methylphenyl]butanamide.
| Compound Name | N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)-2-methylphenyl]butanamide |
|---|---|
| PubChem CID | 46268849 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)-2-methylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(N2CCn3c(nc4ccccc43)C2)cc1C |
| InChI | InChI=1S/C21H24N4O/c1-3-6-21(26)23-17-10-9-16(13-15(17)2)24-11-12-25-19-8-5-4-7-18(19)22-20(25)14-24/h4-5,7-10,13H,3,6,11-12,14H2,1-2H3,(H,23,26) |
| InChIKey | XTAPSVULJZDSHE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|