C24H21FN4O — CID 46268862
N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)-2-methylphenyl]-4-fluorobenzamide (PubChem CID 46268862) has the molecular formula C24H21FN4O and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)-2-methylphenyl]-4-fluorobenzamide.
| Compound Name | N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)-2-methylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46268862 |
| Molecular Formula | C24H21FN4O |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)-2-methylphenyl]-4-fluorobenzamide |
| SMILES | Cc1cc(N2CCn3c(nc4ccccc43)C2)ccc1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21FN4O/c1-16-14-19(10-11-20(16)27-24(30)17-6-8-18(25)9-7-17)28-12-13-29-22-5-3-2-4-21(22)26-23(29)15-28/h2-11,14H,12-13,15H2,1H3,(H,27,30) |
| InChIKey | ZDUPLBPLMREKER-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|