C26H26N4O3 — CID 29136286
4-methoxy-N-[2-methoxy-5-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]benzimidazol-2-yl)phenyl]benzamide (PubChem CID 29136286) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-methoxy-N-[2-methoxy-5-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]benzimidazol-2-yl)phenyl]benzamide.
| Compound Name | 4-methoxy-N-[2-methoxy-5-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]benzimidazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 29136286 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-methoxy-N-[2-methoxy-5-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]benzimidazol-2-yl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(N3CCCn4c(nc5ccccc54)C3)ccc2OC)cc1 |
| InChI | InChI=1S/C26H26N4O3/c1-32-20-11-8-18(9-12-20)26(31)28-22-16-19(10-13-24(22)33-2)29-14-5-15-30-23-7-4-3-6-21(23)27-25(30)17-29/h3-4,6-13,16H,5,14-15,17H2,1-2H3,(H,28,31) |
| InChIKey | OZHGBMHOJPDOLB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|