C24H22N4O2 — CID 46268824
N-[3-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)phenyl]-2-methoxybenzamide (PubChem CID 46268824) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)phenyl]-2-methoxybenzamide.
| Compound Name | N-[3-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46268824 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-2-yl)phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1cccc(N2CCn3c(nc4ccccc43)C2)c1 |
| InChI | InChI=1S/C24H22N4O2/c1-30-22-12-5-2-9-19(22)24(29)25-17-7-6-8-18(15-17)27-13-14-28-21-11-4-3-10-20(21)26-23(28)16-27/h2-12,15H,13-14,16H2,1H3,(H,25,29) |
| InChIKey | UIAJSHSTKOWXNQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|