C29H32N4O2 — CID 26340701
N-[3-[4-(2-indol-1-ylethylamino)piperidin-1-yl]phenyl]-2-methoxybenzamide (PubChem CID 26340701) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[3-[4-(2-indol-1-ylethylamino)piperidin-1-yl]phenyl]-2-methoxybenzamide.
| Compound Name | N-[3-[4-(2-indol-1-ylethylamino)piperidin-1-yl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 26340701 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-[3-[4-(2-indol-1-ylethylamino)piperidin-1-yl]phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1cccc(N2CCC(NCCn3ccc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C29H32N4O2/c1-35-28-12-5-3-10-26(28)29(34)31-24-8-6-9-25(21-24)32-18-14-23(15-19-32)30-16-20-33-17-13-22-7-2-4-11-27(22)33/h2-13,17,21,23,30H,14-16,18-20H2,1H3,(H,31,34) |
| InChIKey | YKVKYDRVQJPVEC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|