C25H30N4O2S — CID 42481674
2-methoxy-N-[3-[4-[[(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]amino]piperidin-1-yl]phenyl]benzamide (PubChem CID 42481674) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is 2-methoxy-N-[3-[4-[[(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]amino]piperidin-1-yl]phenyl]benzamide.
| Compound Name | 2-methoxy-N-[3-[4-[[(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]amino]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42481674 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-methoxy-N-[3-[4-[[(1R)-1-(2-methyl-1,3-thiazol-4-yl)ethyl]amino]piperidin-1-yl]phenyl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1cccc(N2CCC(N[C@H](C)c3csc(C)n3)CC2)c1 |
| InChI | InChI=1S/C25H30N4O2S/c1-17(23-16-32-18(2)27-23)26-19-11-13-29(14-12-19)21-8-6-7-20(15-21)28-25(30)22-9-4-5-10-24(22)31-3/h4-10,15-17,19,26H,11-14H2,1-3H3,(H,28,30)/t17-/m1/s1 |
| InChIKey | KPEIJGXEAMXAGB-QGZVFWFLSA-N |
| XLogP | 5.03 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|