C18H21N3O4 — CID 46271642
3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-(4-methoxyphenyl)propanamide (PubChem CID 46271642) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-(4-methoxyphenyl)propanamide.
| Compound Name | 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 46271642 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCNc2c(N3CCCC3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-25-13-6-4-12(5-7-13)20-14(22)8-9-19-15-16(18(24)17(15)23)21-10-2-3-11-21/h4-7,19H,2-3,8-11H2,1H3,(H,20,22) |
| InChIKey | BVGDOTHYPANWCP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|