C17H18FN3O3 — CID 46271658
3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-(2-fluorophenyl)propanamide (PubChem CID 46271658) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 46271658 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]-N-(2-fluorophenyl)propanamide |
| SMILES | O=C(CCNc1c(N2CCCC2)c(=O)c1=O)Nc1ccccc1F |
| InChI | InChI=1S/C17H18FN3O3/c18-11-5-1-2-6-12(11)20-13(22)7-8-19-14-15(17(24)16(14)23)21-9-3-4-10-21/h1-2,5-6,19H,3-4,7-10H2,(H,20,22) |
| InChIKey | QCMJIZOPIYMKIT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|