C19H16N2O5 — CID 46271728
N-(2,4-dimethoxyphenyl)-4H-chromeno[3,4-d][1,2]oxazole-3-carboxamide (PubChem CID 46271728) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4H-chromeno[3,4-d][1,2]oxazole-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4H-chromeno[3,4-d][1,2]oxazole-3-carboxamide |
|---|---|
| PubChem CID | 46271728 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4H-chromeno[3,4-d][1,2]oxazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2noc3c2COc2ccccc2-3)c(OC)c1 |
| InChI | InChI=1S/C19H16N2O5/c1-23-11-7-8-14(16(9-11)24-2)20-19(22)17-13-10-25-15-6-4-3-5-12(15)18(13)26-21-17/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | LJVTXQXQPMWIPM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |