C22H21N5O4 — CID 46271886
(1-methyl-4H-chromeno[3,4-d]pyrazol-3-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 46271886) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is (1-methyl-4H-chromeno[3,4-d]pyrazol-3-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (1-methyl-4H-chromeno[3,4-d]pyrazol-3-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46271886 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (1-methyl-4H-chromeno[3,4-d]pyrazol-3-yl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cn1nc(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c2c1-c1ccccc1OC2 |
| InChI | InChI=1S/C22H21N5O4/c1-24-21-17-4-2-3-5-19(17)31-14-18(21)20(23-24)22(28)26-12-10-25(11-13-26)15-6-8-16(9-7-15)27(29)30/h2-9H,10-14H2,1H3 |
| InChIKey | DUCXYIBIEASMSM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|