C16H15N3O6S — CID 46273346
N-(3,4-dimethoxyphenyl)-5-nitro-1H-indole-3-sulfonamide (PubChem CID 46273346) has the molecular formula C16H15N3O6S and a molecular weight of 377.38 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-nitro-1H-indole-3-sulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-nitro-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 46273346 |
| Molecular Formula | C16H15N3O6S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-nitro-1H-indole-3-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2c[nH]c3ccc([N+](=O)[O-])cc23)cc1OC |
| InChI | InChI=1S/C16H15N3O6S/c1-24-14-6-3-10(7-15(14)25-2)18-26(22,23)16-9-17-13-5-4-11(19(20)21)8-12(13)16/h3-9,17-18H,1-2H3 |
| InChIKey | CXMWLYGVJGVKBB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|