C18H19N3O7S — CID 90799743
N-methyl-5-nitro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-sulfonamide (PubChem CID 90799743) has the molecular formula C18H19N3O7S and a molecular weight of 421.43 g/mol. Its IUPAC name is N-methyl-5-nitro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-sulfonamide.
| Compound Name | N-methyl-5-nitro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 90799743 |
| Molecular Formula | C18H19N3O7S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-methyl-5-nitro-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-sulfonamide |
| SMILES | COc1cc(N(C)S(=O)(=O)c2c[nH]c3ccc([N+](=O)[O-])cc23)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N3O7S/c1-20(12-8-15(26-2)18(28-4)16(9-12)27-3)29(24,25)17-10-19-14-6-5-11(21(22)23)7-13(14)17/h5-10,19H,1-4H3 |
| InChIKey | KZSXXPQBKBJQST-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|