C18H16N4O5 — CID 46274716
2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 46274716) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 46274716 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | COc1ccc(-c2noc(CC(=O)Nc3cccc([N+](=O)[O-])c3C)n2)cc1 |
| InChI | InChI=1S/C18H16N4O5/c1-11-14(4-3-5-15(11)22(24)25)19-16(23)10-17-20-18(21-27-17)12-6-8-13(26-2)9-7-12/h3-9H,10H2,1-2H3,(H,19,23) |
| InChIKey | VNZFPDMQOACPFG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|