C18H16FN3O4S — CID 46275018
N-(2-fluorophenyl)-3-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]propanamide (PubChem CID 46275018) has the molecular formula C18H16FN3O4S and a molecular weight of 389.41 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 46275018 |
| Molecular Formula | C18H16FN3O4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-(2-fluorophenyl)-3-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)ccc2c1)Nc1ccccc1F |
| InChI | InChI=1S/C18H16FN3O4S/c19-14-3-1-2-4-16(14)22-18(24)9-10-20-27(25,26)13-6-7-15-12(11-13)5-8-17(23)21-15/h1-8,11,20H,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | MLUGNTFFORLZRR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |