C19H25N3O4S — CID 46275051
N-(2-methylcyclohexyl)-3-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]propanamide (PubChem CID 46275051) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-3-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]propanamide.
| Compound Name | N-(2-methylcyclohexyl)-3-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 46275051 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-(2-methylcyclohexyl)-3-[(2-oxo-1H-quinolin-6-yl)sulfonylamino]propanamide |
| SMILES | CC1CCCCC1NC(=O)CCNS(=O)(=O)c1ccc2[nH]c(=O)ccc2c1 |
| InChI | InChI=1S/C19H25N3O4S/c1-13-4-2-3-5-16(13)21-19(24)10-11-20-27(25,26)15-7-8-17-14(12-15)6-9-18(23)22-17/h6-9,12-13,16,20H,2-5,10-11H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | RBSFYSMVDFLFHJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |