C16H23BrN2O3S — CID 9403540
3-[(4-bromophenyl)sulfonylamino]-N-[(1S,2R)-2-methylcyclohexyl]propanamide (PubChem CID 9403540) has the molecular formula C16H23BrN2O3S and a molecular weight of 403.34 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-[(1S,2R)-2-methylcyclohexyl]propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-[(1S,2R)-2-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 9403540 |
| Molecular Formula | C16H23BrN2O3S |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-[(1S,2R)-2-methylcyclohexyl]propanamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)CCNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H23BrN2O3S/c1-12-4-2-3-5-15(12)19-16(20)10-11-18-23(21,22)14-8-6-13(17)7-9-14/h6-9,12,15,18H,2-5,10-11H2,1H3,(H,19,20)/t12-,15+/m1/s1 |
| InChIKey | JJCWHCGVTNOCBL-DOMZBBRYSA-N |
| XLogP | 2.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |