C17H25N3O6S — CID 9265727
3-[(4-methoxy-3-nitrophenyl)sulfonylamino]-N-[(1R,2S)-2-methylcyclohexyl]propanamide (PubChem CID 9265727) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[(4-methoxy-3-nitrophenyl)sulfonylamino]-N-[(1R,2S)-2-methylcyclohexyl]propanamide.
| Compound Name | 3-[(4-methoxy-3-nitrophenyl)sulfonylamino]-N-[(1R,2S)-2-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 9265727 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 3-[(4-methoxy-3-nitrophenyl)sulfonylamino]-N-[(1R,2S)-2-methylcyclohexyl]propanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCC[C@@H]2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O6S/c1-12-5-3-4-6-14(12)19-17(21)9-10-18-27(24,25)13-7-8-16(26-2)15(11-13)20(22)23/h7-8,11-12,14,18H,3-6,9-10H2,1-2H3,(H,19,21)/t12-,14+/m0/s1 |
| InChIKey | SJONSQPCNAMNIG-GXTWGEPZSA-N |
| XLogP | 1.97 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|