C25H26FN5O3 — CID 46275111
[3-(3-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-1-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 46275111) has the molecular formula C25H26FN5O3 and a molecular weight of 463.51 g/mol. Its IUPAC name is [3-(3-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-1-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(3-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-1-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46275111 |
| Molecular Formula | C25H26FN5O3 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [3-(3-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepin-1-yl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1nc(-c2cccc(F)c2)n2c1CCCCC2)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C25H26FN5O3/c26-19-6-4-5-18(17-19)24-27-23(22-7-2-1-3-12-30(22)24)25(32)29-15-13-28(14-16-29)20-8-10-21(11-9-20)31(33)34/h4-6,8-11,17H,1-3,7,12-16H2 |
| InChIKey | FOASGQYLIZEYIR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|