C23H30FN3O — CID 20904958
N-(2,3-dimethylcyclohexyl)-3-(3-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide (PubChem CID 20904958) has the molecular formula C23H30FN3O and a molecular weight of 383.51 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-3-(3-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-3-(3-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide |
|---|---|
| PubChem CID | 20904958 |
| Molecular Formula | C23H30FN3O |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-3-(3-fluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2nc(-c3cccc(F)c3)n3c2CCCCC3)C1C |
| InChI | InChI=1S/C23H30FN3O/c1-15-8-6-11-19(16(15)2)25-23(28)21-20-12-4-3-5-13-27(20)22(26-21)17-9-7-10-18(24)14-17/h7,9-10,14-16,19H,3-6,8,11-13H2,1-2H3,(H,25,28) |
| InChIKey | HBVXLIGLIRIQJU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |