C23H17N3O3S — CID 46275218
N-acridin-9-yl-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetamide (PubChem CID 46275218) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-acridin-9-yl-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetamide.
| Compound Name | N-acridin-9-yl-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetamide |
|---|---|
| PubChem CID | 46275218 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-acridin-9-yl-2-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methoxy]acetamide |
| SMILES | O=C(COCc1cc(-c2cccs2)on1)Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C23H17N3O3S/c27-22(14-28-13-15-12-20(29-26-15)21-10-5-11-30-21)25-23-16-6-1-3-8-18(16)24-19-9-4-2-7-17(19)23/h1-12H,13-14H2,(H,24,25,27) |
| InChIKey | VJJRPCQGLDNETA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|