C21H31N3O5S — CID 46275608
N-cycloheptyl-1-(3-methoxyphenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide (PubChem CID 46275608) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is N-cycloheptyl-1-(3-methoxyphenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide.
| Compound Name | N-cycloheptyl-1-(3-methoxyphenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 46275608 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-cycloheptyl-1-(3-methoxyphenyl)-2-methyl-4-methylsulfonyl-6-oxopiperazine-2-carboxamide |
| SMILES | COc1cccc(N2C(=O)CN(S(C)(=O)=O)CC2(C)C(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C21H31N3O5S/c1-21(20(26)22-16-9-6-4-5-7-10-16)15-23(30(3,27)28)14-19(25)24(21)17-11-8-12-18(13-17)29-2/h8,11-13,16H,4-7,9-10,14-15H2,1-3H3,(H,22,26) |
| InChIKey | JDNVKINTFURXPS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |