C24H21ClN2O5S — CID 46276827
(3E)-1-[(4-chlorophenyl)methyl]-3-[(2,5-dimethoxyanilino)methylidene]-2,2-dioxo-2λ6,1-benzothiazin-4-one (PubChem CID 46276827) has the molecular formula C24H21ClN2O5S and a molecular weight of 484.96 g/mol. Its IUPAC name is (3E)-1-[(4-chlorophenyl)methyl]-3-[(2,5-dimethoxyanilino)methylidene]-2,2-dioxo-2λ6,1-benzothiazin-4-one.
| Compound Name | (3E)-1-[(4-chlorophenyl)methyl]-3-[(2,5-dimethoxyanilino)methylidene]-2,2-dioxo-2λ6,1-benzothiazin-4-one |
|---|---|
| PubChem CID | 46276827 |
| Molecular Formula | C24H21ClN2O5S |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (3E)-1-[(4-chlorophenyl)methyl]-3-[(2,5-dimethoxyanilino)methylidene]-2,2-dioxo-2λ6,1-benzothiazin-4-one |
| SMILES | COc1ccc(OC)c(N/C=C2\C(=O)c3ccccc3N(Cc3ccc(Cl)cc3)S2(=O)=O)c1 |
| InChI | InChI=1S/C24H21ClN2O5S/c1-31-18-11-12-22(32-2)20(13-18)26-14-23-24(28)19-5-3-4-6-21(19)27(33(23,29)30)15-16-7-9-17(25)10-8-16/h3-14,26H,15H2,1-2H3/b23-14+ |
| InChIKey | HRKLIESDNCRFIU-OEAKJJBVSA-N |
| XLogP | 4.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|