C22H19ClN2O5S2 — CID 46280766
(3Z)-1-[(4-chlorophenyl)methyl]-3-[(2,4-dimethoxyanilino)methylidene]-2,2-dioxothieno[3,2-c]thiazin-4-one (PubChem CID 46280766) has the molecular formula C22H19ClN2O5S2 and a molecular weight of 490.99 g/mol. Its IUPAC name is (3Z)-1-[(4-chlorophenyl)methyl]-3-[(2,4-dimethoxyanilino)methylidene]-2,2-dioxothieno[3,2-c]thiazin-4-one.
| Compound Name | (3Z)-1-[(4-chlorophenyl)methyl]-3-[(2,4-dimethoxyanilino)methylidene]-2,2-dioxothieno[3,2-c]thiazin-4-one |
|---|---|
| PubChem CID | 46280766 |
| Molecular Formula | C22H19ClN2O5S2 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | (3Z)-1-[(4-chlorophenyl)methyl]-3-[(2,4-dimethoxyanilino)methylidene]-2,2-dioxothieno[3,2-c]thiazin-4-one |
| SMILES | COc1ccc(N/C=C2/C(=O)c3sccc3N(Cc3ccc(Cl)cc3)S2(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C22H19ClN2O5S2/c1-29-16-7-8-17(19(11-16)30-2)24-12-20-21(26)22-18(9-10-31-22)25(32(20,27)28)13-14-3-5-15(23)6-4-14/h3-12,24H,13H2,1-2H3/b20-12- |
| InChIKey | AELIACHIAJKIGU-NDENLUEZSA-N |
| XLogP | 4.90 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|