C23H22N2O5S2 — CID 46280742
(3Z)-3-[(3,5-dimethoxyanilino)methylidene]-1-[(4-methylphenyl)methyl]-2,2-dioxothieno[3,2-c]thiazin-4-one (PubChem CID 46280742) has the molecular formula C23H22N2O5S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethoxyanilino)methylidene]-1-[(4-methylphenyl)methyl]-2,2-dioxothieno[3,2-c]thiazin-4-one.
| Compound Name | (3Z)-3-[(3,5-dimethoxyanilino)methylidene]-1-[(4-methylphenyl)methyl]-2,2-dioxothieno[3,2-c]thiazin-4-one |
|---|---|
| PubChem CID | 46280742 |
| Molecular Formula | C23H22N2O5S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (3Z)-3-[(3,5-dimethoxyanilino)methylidene]-1-[(4-methylphenyl)methyl]-2,2-dioxothieno[3,2-c]thiazin-4-one |
| SMILES | COc1cc(N/C=C2/C(=O)c3sccc3N(Cc3ccc(C)cc3)S2(=O)=O)cc(OC)c1 |
| InChI | InChI=1S/C23H22N2O5S2/c1-15-4-6-16(7-5-15)14-25-20-8-9-31-23(20)22(26)21(32(25,27)28)13-24-17-10-18(29-2)12-19(11-17)30-3/h4-13,24H,14H2,1-3H3/b21-13- |
| InChIKey | DFGMQWSZEFFPAH-BKUYFWCQSA-N |
| XLogP | 4.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|