C20H16N2O3S2 — CID 46280629
(3Z)-3-(anilinomethylidene)-1-benzyl-2,2-dioxothieno[3,2-c]thiazin-4-one (PubChem CID 46280629) has the molecular formula C20H16N2O3S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (3Z)-3-(anilinomethylidene)-1-benzyl-2,2-dioxothieno[3,2-c]thiazin-4-one.
| Compound Name | (3Z)-3-(anilinomethylidene)-1-benzyl-2,2-dioxothieno[3,2-c]thiazin-4-one |
|---|---|
| PubChem CID | 46280629 |
| Molecular Formula | C20H16N2O3S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (3Z)-3-(anilinomethylidene)-1-benzyl-2,2-dioxothieno[3,2-c]thiazin-4-one |
| SMILES | O=C1/C(=C/Nc2ccccc2)S(=O)(=O)N(Cc2ccccc2)c2ccsc21 |
| InChI | InChI=1S/C20H16N2O3S2/c23-19-18(13-21-16-9-5-2-6-10-16)27(24,25)22(17-11-12-26-20(17)19)14-15-7-3-1-4-8-15/h1-13,21H,14H2/b18-13- |
| InChIKey | MDCCPRGOJMSISD-AQTBWJFISA-N |
| XLogP | 4.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|