C19H20N2O4S2 — CID 92692460
(3Z)-1-benzyl-2,2-dioxo-3-[[[(2S)-oxolan-2-yl]methylamino]methylidene]thieno[3,2-c]thiazin-4-one (PubChem CID 92692460) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3Z)-1-benzyl-2,2-dioxo-3-[[[(2S)-oxolan-2-yl]methylamino]methylidene]thieno[3,2-c]thiazin-4-one.
| Compound Name | (3Z)-1-benzyl-2,2-dioxo-3-[[[(2S)-oxolan-2-yl]methylamino]methylidene]thieno[3,2-c]thiazin-4-one |
|---|---|
| PubChem CID | 92692460 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (3Z)-1-benzyl-2,2-dioxo-3-[[[(2S)-oxolan-2-yl]methylamino]methylidene]thieno[3,2-c]thiazin-4-one |
| SMILES | O=C1/C(=C/NC[C@@H]2CCCO2)S(=O)(=O)N(Cc2ccccc2)c2ccsc21 |
| InChI | InChI=1S/C19H20N2O4S2/c22-18-17(12-20-11-15-7-4-9-25-15)27(23,24)21(16-8-10-26-19(16)18)13-14-5-2-1-3-6-14/h1-3,5-6,8,10,12,15,20H,4,7,9,11,13H2/b17-12-/t15-/m0/s1 |
| InChIKey | ZRJBWQBHZQUVAG-ZKMNFCBKSA-N |
| XLogP | 2.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|