C16H19N3O2S2 — CID 42585843
4-amino-3-benzyl-N-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 42585843) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-amino-3-benzyl-N-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-3-benzyl-N-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 42585843 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-amino-3-benzyl-N-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | Nc1c(C(=O)NC[C@H]2CCCO2)sc(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C16H19N3O2S2/c17-14-13(15(20)18-9-12-7-4-8-21-12)23-16(22)19(14)10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10,17H2,(H,18,20)/t12-/m1/s1 |
| InChIKey | FXUUWEHTMAHPCU-GFCCVEGCSA-N |
| XLogP | 2.82 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|