C22H17FN2O5S2 — CID 46280917
methyl 4-[[(Z)-[1-[(3-fluorophenyl)methyl]-2,2,4-trioxothieno[3,2-c]thiazin-3-ylidene]methyl]amino]benzoate (PubChem CID 46280917) has the molecular formula C22H17FN2O5S2 and a molecular weight of 472.52 g/mol. Its IUPAC name is methyl 4-[[(Z)-[1-[(3-fluorophenyl)methyl]-2,2,4-trioxothieno[3,2-c]thiazin-3-ylidene]methyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-[1-[(3-fluorophenyl)methyl]-2,2,4-trioxothieno[3,2-c]thiazin-3-ylidene]methyl]amino]benzoate |
|---|---|
| PubChem CID | 46280917 |
| Molecular Formula | C22H17FN2O5S2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | methyl 4-[[(Z)-[1-[(3-fluorophenyl)methyl]-2,2,4-trioxothieno[3,2-c]thiazin-3-ylidene]methyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N/C=C2/C(=O)c3sccc3N(Cc3cccc(F)c3)S2(=O)=O)cc1 |
| InChI | InChI=1S/C22H17FN2O5S2/c1-30-22(27)15-5-7-17(8-6-15)24-12-19-20(26)21-18(9-10-31-21)25(32(19,28)29)13-14-3-2-4-16(23)11-14/h2-12,24H,13H2,1H3/b19-12- |
| InChIKey | YXKLWSFYZUJWSM-UNOMPAQXSA-N |
| XLogP | 4.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|