C23H22N4O — CID 46277287
3-imidazo[4,5-b]pyridin-3-yl-4-methyl-N-(3-phenylpropyl)benzamide (PubChem CID 46277287) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-imidazo[4,5-b]pyridin-3-yl-4-methyl-N-(3-phenylpropyl)benzamide.
| Compound Name | 3-imidazo[4,5-b]pyridin-3-yl-4-methyl-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 46277287 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 3-imidazo[4,5-b]pyridin-3-yl-4-methyl-N-(3-phenylpropyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCCCc2ccccc2)cc1-n1cnc2cccnc21 |
| InChI | InChI=1S/C23H22N4O/c1-17-11-12-19(23(28)25-14-5-9-18-7-3-2-4-8-18)15-21(17)27-16-26-20-10-6-13-24-22(20)27/h2-4,6-8,10-13,15-16H,5,9,14H2,1H3,(H,25,28) |
| InChIKey | FJFNHBIBXYEMOI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|